| Name | methyl 6-chloro-6-oxohexanoate |
| Synonyms | Methyl adipyl chloride METHYL ADIPOYL CHLORIDE mono-Methyl adipoyl chloride methyl 6-chloro-6-oxohexanoate Methyl 6-chloro-6-oxohexanoate METHYL 5-(CHLOROFORMYL)VALERATE Methyl 5-(chloroformyl)pentanoate ADIPIC ACID MONOMETHYL ESTER CHLORIDE Hexanoic acid, 6-chloro-6-oxo-, methyl ester |
| CAS | 35444-44-1 |
| EINECS | 252-569-1 |
| InChI | InChI=1/C7H11ClO3/c1-11-7(10)5-3-2-4-6(8)9/h2-5H2,1H3 |
| Molecular Formula | C7H11ClO3 |
| Molar Mass | 178.61 |
| Density | 1.149g/mLat 20°C(lit.) |
| Boling Point | 76°C0.8mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.186mmHg at 25°C |
| Specific Gravity | 1.149 |
| BRN | 1766187 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.4470(lit.) |
| MDL | MFCD00013661 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| Hazard Class | 8 |
| Packing Group | II |
| Downstream Products | METHYL OCTACOSANOATE ADIPIC SEMIALDEHYDE METHYL ESTER |
| Specific gravity | 1.149 |
| sensitivity | Moisture Sensitive |
| BRN | 1766187 |
| Hazard Note | Corrosive/Moisture Sensitive |